C13H14FN — CID 43632505
3-(3-fluorophenyl)-N-prop-2-ynylcyclobutan-1-amine (PubChem CID 43632505) has the molecular formula C13H14FN and a molecular weight of 203.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-prop-2-ynylcyclobutan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-N-prop-2-ynylcyclobutan-1-amine |
|---|---|
| PubChem CID | 43632505 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(3-fluorophenyl)-N-prop-2-ynylcyclobutan-1-amine |
| SMILES | C#CCNC1CC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H14FN/c1-2-6-15-13-8-11(9-13)10-4-3-5-12(14)7-10/h1,3-5,7,11,13,15H,6,8-9H2 |
| InChIKey | HXBNGWLBYQKAPX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|