C14H21FN2 — CID 60895802
N'-[3-(3-fluorophenyl)cyclobutyl]butane-1,4-diamine (PubChem CID 60895802) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is N'-[3-(3-fluorophenyl)cyclobutyl]butane-1,4-diamine.
| Compound Name | N'-[3-(3-fluorophenyl)cyclobutyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 60895802 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N'-[3-(3-fluorophenyl)cyclobutyl]butane-1,4-diamine |
| SMILES | NCCCCNC1CC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H21FN2/c15-13-5-3-4-11(8-13)12-9-14(10-12)17-7-2-1-6-16/h3-5,8,12,14,17H,1-2,6-7,9-10,16H2 |
| InChIKey | ZASHWGHEOULBEQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|