C15H18FN3 — CID 65232395
3-(3-fluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]cyclobutan-1-amine (PubChem CID 65232395) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]cyclobutan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 65232395 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[2-(1H-imidazol-5-yl)ethyl]cyclobutan-1-amine |
| SMILES | Fc1cccc(C2CC(NCCc3cnc[nH]3)C2)c1 |
| InChI | InChI=1S/C15H18FN3/c16-13-3-1-2-11(6-13)12-7-15(8-12)18-5-4-14-9-17-10-19-14/h1-3,6,9-10,12,15,18H,4-5,7-8H2,(H,17,19) |
| InChIKey | WGPIWXLPNRNREV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |