C15H18FN — CID 116643185
3-(3-fluorophenyl)-N-pent-3-ynylcyclobutan-1-amine (PubChem CID 116643185) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-pent-3-ynylcyclobutan-1-amine.
| Compound Name | 3-(3-fluorophenyl)-N-pent-3-ynylcyclobutan-1-amine |
|---|---|
| PubChem CID | 116643185 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-pent-3-ynylcyclobutan-1-amine |
| SMILES | CC#CCCNC1CC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H18FN/c1-2-3-4-8-17-15-10-13(11-15)12-6-5-7-14(16)9-12/h5-7,9,13,15,17H,4,8,10-11H2,1H3 |
| InChIKey | XMWLWULJYFADGO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|