C14H15N3O2 — CID 43636189
2-[(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)amino]benzonitrile (PubChem CID 43636189) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)amino]benzonitrile.
| Compound Name | 2-[(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 43636189 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(2,5-dioxo-1-propan-2-ylpyrrolidin-3-yl)amino]benzonitrile |
| SMILES | CC(C)N1C(=O)CC(Nc2ccccc2C#N)C1=O |
| InChI | InChI=1S/C14H15N3O2/c1-9(2)17-13(18)7-12(14(17)19)16-11-6-4-3-5-10(11)8-15/h3-6,9,12,16H,7H2,1-2H3 |
| InChIKey | YFLIHIGJFISDEJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|