C16H19N3O2 — CID 107804189
2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-6-methylbenzonitrile (PubChem CID 107804189) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-6-methylbenzonitrile.
| Compound Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-6-methylbenzonitrile |
|---|---|
| PubChem CID | 107804189 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-6-methylbenzonitrile |
| SMILES | CCC(C)N1C(=O)CC(Nc2cccc(C)c2C#N)C1=O |
| InChI | InChI=1S/C16H19N3O2/c1-4-11(3)19-15(20)8-14(16(19)21)18-13-7-5-6-10(2)12(13)9-17/h5-7,11,14,18H,4,8H2,1-3H3 |
| InChIKey | YMGYOAZJAXIUAG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|