C16H19N3O2 — CID 43637969
3-[(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)amino]benzonitrile (PubChem CID 43637969) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)amino]benzonitrile.
| Compound Name | 3-[(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 43637969 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[(2,5-dioxo-1-pentan-3-ylpyrrolidin-3-yl)amino]benzonitrile |
| SMILES | CCC(CC)N1C(=O)CC(Nc2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C16H19N3O2/c1-3-13(4-2)19-15(20)9-14(16(19)21)18-12-7-5-6-11(8-12)10-17/h5-8,13-14,18H,3-4,9H2,1-2H3 |
| InChIKey | HDASACRYMOETAO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|