C15H16FN3O2 — CID 82016968
2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-5-fluorobenzonitrile (PubChem CID 82016968) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-5-fluorobenzonitrile.
| Compound Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 82016968 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[(1-butan-2-yl-2,5-dioxopyrrolidin-3-yl)amino]-5-fluorobenzonitrile |
| SMILES | CCC(C)N1C(=O)CC(Nc2ccc(F)cc2C#N)C1=O |
| InChI | InChI=1S/C15H16FN3O2/c1-3-9(2)19-14(20)7-13(15(19)21)18-12-5-4-11(16)6-10(12)8-17/h4-6,9,13,18H,3,7H2,1-2H3 |
| InChIKey | OVKWZNYNXMWEFL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|