C14H21N3O — CID 43639228
[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-propan-2-ylpyrrol-2-yl)methanone (PubChem CID 43639228) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-propan-2-ylpyrrol-2-yl)methanone.
| Compound Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-propan-2-ylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 43639228 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | [(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-(1-propan-2-ylpyrrol-2-yl)methanone |
| SMILES | CC(C)n1cccc1C(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C14H21N3O/c1-10(2)16-6-3-4-12(16)14(18)17-7-5-11-8-15-9-13(11)17/h3-4,6,10-11,13,15H,5,7-9H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | MXUZREVJTWJTCF-WCQYABFASA-N |
| XLogP | 1.50 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |