C12H12N4O2 — CID 43643909
4-amino-N-(2-carbamoylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 43643909) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-amino-N-(2-carbamoylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2-carbamoylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643909 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-amino-N-(2-carbamoylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)c1cc(N)c[nH]1 |
| InChI | InChI=1S/C12H12N4O2/c13-7-5-10(15-6-7)12(18)16-9-4-2-1-3-8(9)11(14)17/h1-6,15H,13H2,(H2,14,17)(H,16,18) |
| InChIKey | YWLQMVHVXMDPEO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |