C14H14N4O3 — CID 166225226
2-N-(3-carbamoyl-2-methylphenyl)-1H-pyrrole-2,4-dicarboxamide (PubChem CID 166225226) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-N-(3-carbamoyl-2-methylphenyl)-1H-pyrrole-2,4-dicarboxamide.
| Compound Name | 2-N-(3-carbamoyl-2-methylphenyl)-1H-pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 166225226 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-N-(3-carbamoyl-2-methylphenyl)-1H-pyrrole-2,4-dicarboxamide |
| SMILES | Cc1c(NC(=O)c2cc(C(N)=O)c[nH]2)cccc1C(N)=O |
| InChI | InChI=1S/C14H14N4O3/c1-7-9(13(16)20)3-2-4-10(7)18-14(21)11-5-8(6-17-11)12(15)19/h2-6,17H,1H3,(H2,15,19)(H2,16,20)(H,18,21) |
| InChIKey | RGOVOIISXXFMDT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |