C15H13N5O2 — CID 167859788
2-N-[2-(1H-imidazol-2-yl)phenyl]-1H-pyrrole-2,4-dicarboxamide (PubChem CID 167859788) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-N-[2-(1H-imidazol-2-yl)phenyl]-1H-pyrrole-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(1H-imidazol-2-yl)phenyl]-1H-pyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 167859788 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-N-[2-(1H-imidazol-2-yl)phenyl]-1H-pyrrole-2,4-dicarboxamide |
| SMILES | NC(=O)c1c[nH]c(C(=O)Nc2ccccc2-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C15H13N5O2/c16-13(21)9-7-12(19-8-9)15(22)20-11-4-2-1-3-10(11)14-17-5-6-18-14/h1-8,19H,(H2,16,21)(H,17,18)(H,20,22) |
| InChIKey | SCGQZJJANGFZSE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |