C15H15N5S — CID 43645285
3-[methyl(pyridin-2-ylmethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 43645285) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 3-[methyl(pyridin-2-ylmethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[methyl(pyridin-2-ylmethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43645285 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[methyl(pyridin-2-ylmethyl)amino]-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | CN(Cc1ccccn1)c1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C15H15N5S/c1-19(11-12-7-5-6-10-16-12)14-17-18-15(21)20(14)13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H,18,21) |
| InChIKey | AXQOAKZJLMPTSI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|