C15H17N3O3 — CID 43647204
2-(4-formyl-3,5-dimethylpyrazol-1-yl)-N-(2-methoxyphenyl)acetamide (PubChem CID 43647204) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-(4-formyl-3,5-dimethylpyrazol-1-yl)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(4-formyl-3,5-dimethylpyrazol-1-yl)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43647204 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(4-formyl-3,5-dimethylpyrazol-1-yl)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)Cn1nc(C)c(C=O)c1C |
| InChI | InChI=1S/C15H17N3O3/c1-10-12(9-19)11(2)18(17-10)8-15(20)16-13-6-4-5-7-14(13)21-3/h4-7,9H,8H2,1-3H3,(H,16,20) |
| InChIKey | MXFPSUVEHMVDED-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|