C12H16ClNO2S — CID 43654489
3-chloro-N-(2,3-dihydro-1H-inden-1-yl)propane-1-sulfonamide (PubChem CID 43654489) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dihydro-1H-inden-1-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2,3-dihydro-1H-inden-1-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654489 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-chloro-N-(2,3-dihydro-1H-inden-1-yl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC1CCc2ccccc21 |
| InChI | InChI=1S/C12H16ClNO2S/c13-8-3-9-17(15,16)14-12-7-6-10-4-1-2-5-11(10)12/h1-2,4-5,12,14H,3,6-9H2 |
| InChIKey | SRAWNJFIYGLHFO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|