C12H17NO3S — CID 95762243
N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-methoxyethanesulfonamide (PubChem CID 95762243) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-methoxyethanesulfonamide.
| Compound Name | N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 95762243 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)N[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H17NO3S/c1-16-8-9-17(14,15)13-12-7-6-10-4-2-3-5-11(10)12/h2-5,12-13H,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | FMVCHLSBJXBTRT-LBPRGKRZSA-N |
| XLogP | 1.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |