C19H22ClNO3S — CID 124721706
N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-phenylmethoxypropane-1-sulfonamide (PubChem CID 124721706) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-phenylmethoxypropane-1-sulfonamide.
| Compound Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-phenylmethoxypropane-1-sulfonamide |
|---|---|
| PubChem CID | 124721706 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]-3-phenylmethoxypropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCOCc1ccccc1)N[C@@H]1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H22ClNO3S/c20-17-8-9-18-16(13-17)7-10-19(18)21-25(22,23)12-4-11-24-14-15-5-2-1-3-6-15/h1-3,5-6,8-9,13,19,21H,4,7,10-12,14H2/t19-/m1/s1 |
| InChIKey | AHJVWVGWWJVRMO-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|