C16H12FN3 — CID 43657383
4-(5,6-dimethylbenzimidazol-1-yl)-3-fluorobenzonitrile (PubChem CID 43657383) has the molecular formula C16H12FN3 and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(5,6-dimethylbenzimidazol-1-yl)-3-fluorobenzonitrile.
| Compound Name | 4-(5,6-dimethylbenzimidazol-1-yl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 43657383 |
| Molecular Formula | C16H12FN3 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(5,6-dimethylbenzimidazol-1-yl)-3-fluorobenzonitrile |
| SMILES | Cc1cc2ncn(-c3ccc(C#N)cc3F)c2cc1C |
| InChI | InChI=1S/C16H12FN3/c1-10-5-14-16(6-11(10)2)20(9-19-14)15-4-3-12(8-18)7-13(15)17/h3-7,9H,1-2H3 |
| InChIKey | OIBOQCUKKRLTCJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |