C15H13BrFN3 — CID 116736349
4-bromo-2-(5,6-dimethylbenzimidazol-1-yl)-5-fluoroaniline (PubChem CID 116736349) has the molecular formula C15H13BrFN3 and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-bromo-2-(5,6-dimethylbenzimidazol-1-yl)-5-fluoroaniline.
| Compound Name | 4-bromo-2-(5,6-dimethylbenzimidazol-1-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 116736349 |
| Molecular Formula | C15H13BrFN3 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 4-bromo-2-(5,6-dimethylbenzimidazol-1-yl)-5-fluoroaniline |
| SMILES | Cc1cc2ncn(-c3cc(Br)c(F)cc3N)c2cc1C |
| InChI | InChI=1S/C15H13BrFN3/c1-8-3-13-15(4-9(8)2)20(7-19-13)14-5-10(16)11(17)6-12(14)18/h3-7H,18H2,1-2H3 |
| InChIKey | ASHWTNSZARMBRP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|