C10H10BrFN4 — CID 116736356
4-bromo-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-fluoroaniline (PubChem CID 116736356) has the molecular formula C10H10BrFN4 and a molecular weight of 285.12 g/mol. Its IUPAC name is 4-bromo-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-fluoroaniline.
| Compound Name | 4-bromo-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 116736356 |
| Molecular Formula | C10H10BrFN4 |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 4-bromo-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-5-fluoroaniline |
| SMILES | Cc1nc(C)n(-c2cc(Br)c(F)cc2N)n1 |
| InChI | InChI=1S/C10H10BrFN4/c1-5-14-6(2)16(15-5)10-3-7(11)8(12)4-9(10)13/h3-4H,13H2,1-2H3 |
| InChIKey | WMOKETHCJGDVBQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|