C16H16ClN3 — CID 62492660
[5-chloro-2-(5,6-dimethylbenzimidazol-1-yl)phenyl]methanamine (PubChem CID 62492660) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is [5-chloro-2-(5,6-dimethylbenzimidazol-1-yl)phenyl]methanamine.
| Compound Name | [5-chloro-2-(5,6-dimethylbenzimidazol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 62492660 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [5-chloro-2-(5,6-dimethylbenzimidazol-1-yl)phenyl]methanamine |
| SMILES | Cc1cc2ncn(-c3ccc(Cl)cc3CN)c2cc1C |
| InChI | InChI=1S/C16H16ClN3/c1-10-5-14-16(6-11(10)2)20(9-19-14)15-4-3-13(17)7-12(15)8-18/h3-7,9H,8,18H2,1-2H3 |
| InChIKey | NQWSDQFCJLSNRO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |