C17H18ClN3 — CID 81159919
2-[3-chloro-4-(5,6-dimethylbenzimidazol-1-yl)phenyl]ethanamine (PubChem CID 81159919) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 2-[3-chloro-4-(5,6-dimethylbenzimidazol-1-yl)phenyl]ethanamine.
| Compound Name | 2-[3-chloro-4-(5,6-dimethylbenzimidazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 81159919 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[3-chloro-4-(5,6-dimethylbenzimidazol-1-yl)phenyl]ethanamine |
| SMILES | Cc1cc2ncn(-c3ccc(CCN)cc3Cl)c2cc1C |
| InChI | InChI=1S/C17H18ClN3/c1-11-7-15-17(8-12(11)2)21(10-20-15)16-4-3-13(5-6-19)9-14(16)18/h3-4,7-10H,5-6,19H2,1-2H3 |
| InChIKey | BYXDUJPNEUKDHC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |