C14H22N2O4S — CID 43663015
3-(2,2-dimethylmorpholin-4-yl)sulfonyl-4-ethoxyaniline (PubChem CID 43663015) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-4-ethoxyaniline.
| Compound Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-4-ethoxyaniline |
|---|---|
| PubChem CID | 43663015 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonyl-4-ethoxyaniline |
| SMILES | CCOc1ccc(N)cc1S(=O)(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C14H22N2O4S/c1-4-19-12-6-5-11(15)9-13(12)21(17,18)16-7-8-20-14(2,3)10-16/h5-6,9H,4,7-8,10,15H2,1-3H3 |
| InChIKey | ZINYTGOZULDYBU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|