C11H12FN3S — CID 43664156
2-(3-fluorophenyl)-N-(thiadiazol-4-ylmethyl)ethanamine (PubChem CID 43664156) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-(thiadiazol-4-ylmethyl)ethanamine.
| Compound Name | 2-(3-fluorophenyl)-N-(thiadiazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43664156 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(3-fluorophenyl)-N-(thiadiazol-4-ylmethyl)ethanamine |
| SMILES | Fc1cccc(CCNCc2csnn2)c1 |
| InChI | InChI=1S/C11H12FN3S/c12-10-3-1-2-9(6-10)4-5-13-7-11-8-16-15-14-11/h1-3,6,8,13H,4-5,7H2 |
| InChIKey | MFYPYMMOKWDUGL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|