C13H13Cl2N — CID 43668494
4,8-dichloro-6-methyl-2-propan-2-ylquinoline (PubChem CID 43668494) has the molecular formula C13H13Cl2N and a molecular weight of 254.16 g/mol. Its IUPAC name is 4,8-dichloro-6-methyl-2-propan-2-ylquinoline.
| Compound Name | 4,8-dichloro-6-methyl-2-propan-2-ylquinoline |
|---|---|
| PubChem CID | 43668494 |
| Molecular Formula | C13H13Cl2N |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4,8-dichloro-6-methyl-2-propan-2-ylquinoline |
| SMILES | Cc1cc(Cl)c2nc(C(C)C)cc(Cl)c2c1 |
| InChI | InChI=1S/C13H13Cl2N/c1-7(2)12-6-10(14)9-4-8(3)5-11(15)13(9)16-12/h4-7H,1-3H3 |
| InChIKey | MUWXNKPFRQFFIQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |