C11H8F3N3O3 — CID 43671594
3-[4-(2,2,2-trifluoroethoxy)phenyl]triazole-4-carboxylic acid (PubChem CID 43671594) has the molecular formula C11H8F3N3O3 and a molecular weight of 287.20 g/mol. Its IUPAC name is 3-[4-(2,2,2-trifluoroethoxy)phenyl]triazole-4-carboxylic acid.
| Compound Name | 3-[4-(2,2,2-trifluoroethoxy)phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43671594 |
| Molecular Formula | C11H8F3N3O3 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-[4-(2,2,2-trifluoroethoxy)phenyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnnn1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F3N3O3/c12-11(13,14)6-20-8-3-1-7(2-4-8)17-9(10(18)19)5-15-16-17/h1-5H,6H2,(H,18,19) |
| InChIKey | PUPIVLDDRNAMKU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |