C19H26ClN — CID 43677413
N-[1-(2-chlorophenyl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43677413) has the molecular formula C19H26ClN and a molecular weight of 303.88 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-[1-(2-chlorophenyl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43677413 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-[1-(2-chlorophenyl)propan-2-yl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CC(Cc1ccccc1Cl)NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C19H26ClN/c1-12(9-13-5-2-3-8-18(13)20)21-19-11-14-10-17(19)16-7-4-6-15(14)16/h2-3,5,8,12,14-17,19,21H,4,6-7,9-11H2,1H3 |
| InChIKey | XVVIBEGOSWCULS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |