C12H24N2O2S — CID 43679758
1-ethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)piperidin-4-amine (PubChem CID 43679758) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-ethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)piperidin-4-amine.
| Compound Name | 1-ethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 43679758 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-ethyl-N-(3-methyl-1,1-dioxothiolan-3-yl)piperidin-4-amine |
| SMILES | CCN1CCC(NC2(C)CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-3-14-7-4-11(5-8-14)13-12(2)6-9-17(15,16)10-12/h11,13H,3-10H2,1-2H3 |
| InChIKey | CPGTXHOIWNBVGA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |