C16H14BrClN2O — CID 43680023
3-[1-(2-bromophenyl)ethylamino]-5-chloro-1,3-dihydroindol-2-one (PubChem CID 43680023) has the molecular formula C16H14BrClN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is 3-[1-(2-bromophenyl)ethylamino]-5-chloro-1,3-dihydroindol-2-one.
| Compound Name | 3-[1-(2-bromophenyl)ethylamino]-5-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43680023 |
| Molecular Formula | C16H14BrClN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 3-[1-(2-bromophenyl)ethylamino]-5-chloro-1,3-dihydroindol-2-one |
| SMILES | CC(NC1C(=O)Nc2ccc(Cl)cc21)c1ccccc1Br |
| InChI | InChI=1S/C16H14BrClN2O/c1-9(11-4-2-3-5-13(11)17)19-15-12-8-10(18)6-7-14(12)20-16(15)21/h2-9,15,19H,1H3,(H,20,21) |
| InChIKey | CROBLAMZYGXCML-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |