C17H15NO2 — CID 43680262
4-[(naphthalen-2-ylamino)methyl]benzene-1,2-diol (PubChem CID 43680262) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-[(naphthalen-2-ylamino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(naphthalen-2-ylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43680262 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[(naphthalen-2-ylamino)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2ccc3ccccc3c2)cc1O |
| InChI | InChI=1S/C17H15NO2/c19-16-8-5-12(9-17(16)20)11-18-15-7-6-13-3-1-2-4-14(13)10-15/h1-10,18-20H,11H2 |
| InChIKey | QYMHAOZLKJHVDJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|