C12H15F2NO3S — CID 43683893
4-(difluoromethylsulfonyl)-N-(oxolan-3-ylmethyl)aniline (PubChem CID 43683893) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(oxolan-3-ylmethyl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(oxolan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 43683893 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(oxolan-3-ylmethyl)aniline |
| SMILES | O=S(=O)(c1ccc(NCC2CCOC2)cc1)C(F)F |
| InChI | InChI=1S/C12H15F2NO3S/c13-12(14)19(16,17)11-3-1-10(2-4-11)15-7-9-5-6-18-8-9/h1-4,9,12,15H,5-8H2 |
| InChIKey | BIXSKMNEMIWDSB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |