C15H23NO3S — CID 71977936
2-methylsulfonyl-N-[(2-propan-2-yloxolan-3-yl)methyl]aniline (PubChem CID 71977936) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(2-propan-2-yloxolan-3-yl)methyl]aniline.
| Compound Name | 2-methylsulfonyl-N-[(2-propan-2-yloxolan-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 71977936 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-methylsulfonyl-N-[(2-propan-2-yloxolan-3-yl)methyl]aniline |
| SMILES | CC(C)C1OCCC1CNc1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C15H23NO3S/c1-11(2)15-12(8-9-19-15)10-16-13-6-4-5-7-14(13)20(3,17)18/h4-7,11-12,15-16H,8-10H2,1-3H3 |
| InChIKey | XDGRLRKALVVWND-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |