C17H18N2O2 — CID 43711232
2-[4-(2,3-dihydro-1H-inden-2-ylamino)phenoxy]acetamide (PubChem CID 43711232) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1H-inden-2-ylamino)phenoxy]acetamide.
| Compound Name | 2-[4-(2,3-dihydro-1H-inden-2-ylamino)phenoxy]acetamide |
|---|---|
| PubChem CID | 43711232 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[4-(2,3-dihydro-1H-inden-2-ylamino)phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(NC2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H18N2O2/c18-17(20)11-21-16-7-5-14(6-8-16)19-15-9-12-3-1-2-4-13(12)10-15/h1-8,15,19H,9-11H2,(H2,18,20) |
| InChIKey | DAZCEULVHAQNGB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|