C13H20N2O2S2 — CID 43715600
N,N-dimethyl-3-(thian-4-ylamino)benzenesulfonamide (PubChem CID 43715600) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is N,N-dimethyl-3-(thian-4-ylamino)benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-(thian-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43715600 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N,N-dimethyl-3-(thian-4-ylamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC2CCSCC2)c1 |
| InChI | InChI=1S/C13H20N2O2S2/c1-15(2)19(16,17)13-5-3-4-12(10-13)14-11-6-8-18-9-7-11/h3-5,10-11,14H,6-9H2,1-2H3 |
| InChIKey | RKOJSTZFKYXZAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |