C15H22N4Se — CID 43715846
N-[1-(1-ethylpiperidin-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715846) has the molecular formula C15H22N4Se and a molecular weight of 337.33 g/mol. Its IUPAC name is N-[1-(1-ethylpiperidin-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[1-(1-ethylpiperidin-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715846 |
| Molecular Formula | C15H22N4Se |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[1-(1-ethylpiperidin-4-yl)ethyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CCN1CCC(C(C)Nc2cccc3n[se]nc23)CC1 |
| InChI | InChI=1S/C15H22N4Se/c1-3-19-9-7-12(8-10-19)11(2)16-13-5-4-6-14-15(13)18-20-17-14/h4-6,11-12,16H,3,7-10H2,1-2H3 |
| InChIKey | LJFOYDIVIOENNA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|