C17H19NO3 — CID 43723819
2-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-4-methoxyphenol (PubChem CID 43723819) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-4-methoxyphenol.
| Compound Name | 2-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 43723819 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CNC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C17H19NO3/c1-20-13-6-7-16(19)12(10-13)11-18-15-8-9-21-17-5-3-2-4-14(15)17/h2-7,10,15,18-19H,8-9,11H2,1H3 |
| InChIKey | SCHWYZCDAPZPLK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|