C16H15F2NO2 — CID 79831854
4-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-2,6-difluorophenol (PubChem CID 79831854) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79831854 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[(3,4-dihydro-2H-chromen-4-ylamino)methyl]-2,6-difluorophenol |
| SMILES | Oc1c(F)cc(CNC2CCOc3ccccc32)cc1F |
| InChI | InChI=1S/C16H15F2NO2/c17-12-7-10(8-13(18)16(12)20)9-19-14-5-6-21-15-4-2-1-3-11(14)15/h1-4,7-8,14,19-20H,5-6,9H2 |
| InChIKey | SSTKBCWCDUKTMR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |