C16H28N2O2S — CID 43725216
N-[4-(2,6-dimethylheptan-4-ylamino)phenyl]methanesulfonamide (PubChem CID 43725216) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is N-[4-(2,6-dimethylheptan-4-ylamino)phenyl]methanesulfonamide.
| Compound Name | N-[4-(2,6-dimethylheptan-4-ylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 43725216 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | N-[4-(2,6-dimethylheptan-4-ylamino)phenyl]methanesulfonamide |
| SMILES | CC(C)CC(CC(C)C)Nc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H28N2O2S/c1-12(2)10-16(11-13(3)4)17-14-6-8-15(9-7-14)18-21(5,19)20/h6-9,12-13,16-18H,10-11H2,1-5H3 |
| InChIKey | MSMQVFALUKYWHD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |