C17H29NO — CID 43731141
2-[1-(2,4,4-trimethylpentan-2-ylamino)propyl]phenol (PubChem CID 43731141) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2-[1-(2,4,4-trimethylpentan-2-ylamino)propyl]phenol.
| Compound Name | 2-[1-(2,4,4-trimethylpentan-2-ylamino)propyl]phenol |
|---|---|
| PubChem CID | 43731141 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-[1-(2,4,4-trimethylpentan-2-ylamino)propyl]phenol |
| SMILES | CCC(NC(C)(C)CC(C)(C)C)c1ccccc1O |
| InChI | InChI=1S/C17H29NO/c1-7-14(13-10-8-9-11-15(13)19)18-17(5,6)12-16(2,3)4/h8-11,14,18-19H,7,12H2,1-6H3 |
| InChIKey | RUGFKFFREIMTKO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|