C16H21N3S — CID 43737702
2-cyclopentylsulfanyl-N-[(1-methylpyrazol-4-yl)methyl]aniline (PubChem CID 43737702) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-[(1-methylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2-cyclopentylsulfanyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43737702 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-[(1-methylpyrazol-4-yl)methyl]aniline |
| SMILES | Cn1cc(CNc2ccccc2SC2CCCC2)cn1 |
| InChI | InChI=1S/C16H21N3S/c1-19-12-13(11-18-19)10-17-15-8-4-5-9-16(15)20-14-6-2-3-7-14/h4-5,8-9,11-12,14,17H,2-3,6-7,10H2,1H3 |
| InChIKey | UUVRQBTYIGTJID-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |