C16H18BrNS2 — CID 43737743
N-[(5-bromothiophen-2-yl)methyl]-2-cyclopentylsulfanylaniline (PubChem CID 43737743) has the molecular formula C16H18BrNS2 and a molecular weight of 368.37 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-cyclopentylsulfanylaniline.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-cyclopentylsulfanylaniline |
|---|---|
| PubChem CID | 43737743 |
| Molecular Formula | C16H18BrNS2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-cyclopentylsulfanylaniline |
| SMILES | Brc1ccc(CNc2ccccc2SC2CCCC2)s1 |
| InChI | InChI=1S/C16H18BrNS2/c17-16-10-9-13(20-16)11-18-14-7-3-4-8-15(14)19-12-5-1-2-6-12/h3-4,7-10,12,18H,1-2,5-6,11H2 |
| InChIKey | KLRUOJJSCQDXRE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |