C14H21ClN2O — CID 43738776
4-chloro-N,N-dimethyl-3-(pentan-3-ylamino)benzamide (PubChem CID 43738776) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-(pentan-3-ylamino)benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-3-(pentan-3-ylamino)benzamide |
|---|---|
| PubChem CID | 43738776 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-(pentan-3-ylamino)benzamide |
| SMILES | CCC(CC)Nc1cc(C(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C14H21ClN2O/c1-5-11(6-2)16-13-9-10(7-8-12(13)15)14(18)17(3)4/h7-9,11,16H,5-6H2,1-4H3 |
| InChIKey | XFPMXFUIGMZVBG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |