C16H19ClN2O2 — CID 62633081
4-chloro-3-[1-(furan-2-yl)propylamino]-N,N-dimethylbenzamide (PubChem CID 62633081) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 4-chloro-3-[1-(furan-2-yl)propylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-chloro-3-[1-(furan-2-yl)propylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 62633081 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-chloro-3-[1-(furan-2-yl)propylamino]-N,N-dimethylbenzamide |
| SMILES | CCC(Nc1cc(C(=O)N(C)C)ccc1Cl)c1ccco1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-4-13(15-6-5-9-21-15)18-14-10-11(7-8-12(14)17)16(20)19(2)3/h5-10,13,18H,4H2,1-3H3 |
| InChIKey | CLFDMMQFJJOQAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |