C15H19N3O2S — CID 43741934
1-(3-phenylpropylamino)-3-(sulfamoylamino)benzene (PubChem CID 43741934) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-(3-phenylpropylamino)-3-(sulfamoylamino)benzene.
| Compound Name | 1-(3-phenylpropylamino)-3-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 43741934 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-(3-phenylpropylamino)-3-(sulfamoylamino)benzene |
| SMILES | NS(=O)(=O)Nc1cccc(NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C15H19N3O2S/c16-21(19,20)18-15-10-4-9-14(12-15)17-11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,12,17-18H,5,8,11H2,(H2,16,19,20) |
| InChIKey | UYATZJBOKABZIJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|