C16H19N3OS — CID 43744305
1-methyl-3-[4-[(4-methylsulfanylphenyl)methylamino]phenyl]urea (PubChem CID 43744305) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 1-methyl-3-[4-[(4-methylsulfanylphenyl)methylamino]phenyl]urea.
| Compound Name | 1-methyl-3-[4-[(4-methylsulfanylphenyl)methylamino]phenyl]urea |
|---|---|
| PubChem CID | 43744305 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-methyl-3-[4-[(4-methylsulfanylphenyl)methylamino]phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(NCc2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C16H19N3OS/c1-17-16(20)19-14-7-5-13(6-8-14)18-11-12-3-9-15(21-2)10-4-12/h3-10,18H,11H2,1-2H3,(H2,17,19,20) |
| InChIKey | YMUYWMQICWPBDG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |