C15H15F2N3O — CID 43744335
1-[4-[(2,6-difluorophenyl)methylamino]phenyl]-3-methylurea (PubChem CID 43744335) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is 1-[4-[(2,6-difluorophenyl)methylamino]phenyl]-3-methylurea.
| Compound Name | 1-[4-[(2,6-difluorophenyl)methylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 43744335 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[4-[(2,6-difluorophenyl)methylamino]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(NCc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H15F2N3O/c1-18-15(21)20-11-7-5-10(6-8-11)19-9-12-13(16)3-2-4-14(12)17/h2-8,19H,9H2,1H3,(H2,18,20,21) |
| InChIKey | GVROEPUWMLFKCP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |