C16H24N2O2 — CID 43747094
4-[1-[(1-cyclopropylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 43747094) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[1-[(1-cyclopropylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 4-[1-[(1-cyclopropylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43747094 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-[1-[(1-cyclopropylpiperidin-4-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(NC1CCN(C2CC2)CC1)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H24N2O2/c1-11(15-5-4-14(19)10-16(15)20)17-12-6-8-18(9-7-12)13-2-3-13/h4-5,10-13,17,19-20H,2-3,6-9H2,1H3 |
| InChIKey | XQMJTJPRRRAIFS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|