C17H22F3N — CID 43747481
N-(3-phenylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 43747481) has the molecular formula C17H22F3N and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(3-phenylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(3-phenylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43747481 |
| Molecular Formula | C17H22F3N |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(3-phenylcyclobutyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)C1CCCC(NC2CC(c3ccccc3)C2)C1 |
| InChI | InChI=1S/C17H22F3N/c18-17(19,20)14-7-4-8-15(11-14)21-16-9-13(10-16)12-5-2-1-3-6-12/h1-3,5-6,13-16,21H,4,7-11H2 |
| InChIKey | YPGHTZZPRCZKAO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |