C15H13Cl3N2O — CID 43761409
N-[3-[(2,3,6-trichlorophenyl)methylamino]phenyl]acetamide (PubChem CID 43761409) has the molecular formula C15H13Cl3N2O and a molecular weight of 343.64 g/mol. Its IUPAC name is N-[3-[(2,3,6-trichlorophenyl)methylamino]phenyl]acetamide.
| Compound Name | N-[3-[(2,3,6-trichlorophenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 43761409 |
| Molecular Formula | C15H13Cl3N2O |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N-[3-[(2,3,6-trichlorophenyl)methylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NCc2c(Cl)ccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2O/c1-9(21)20-11-4-2-3-10(7-11)19-8-12-13(16)5-6-14(17)15(12)18/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | BAVJGZQXNDFKTA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|