C18H19N3 — CID 43762376
2-[(2-pyrrolidin-1-ylphenyl)methylamino]benzonitrile (PubChem CID 43762376) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(2-pyrrolidin-1-ylphenyl)methylamino]benzonitrile.
| Compound Name | 2-[(2-pyrrolidin-1-ylphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 43762376 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 2-[(2-pyrrolidin-1-ylphenyl)methylamino]benzonitrile |
| SMILES | N#Cc1ccccc1NCc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C18H19N3/c19-13-15-7-1-3-9-17(15)20-14-16-8-2-4-10-18(16)21-11-5-6-12-21/h1-4,7-10,20H,5-6,11-12,14H2 |
| InChIKey | BMPJAFHCUHMLOB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |